C12H14N2O3S — CID 110760491
2-methyl-5-pyrrolidin-1-ylsulfonyl-1,3-benzoxazole (PubChem CID 110760491) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-methyl-5-pyrrolidin-1-ylsulfonyl-1,3-benzoxazole.
| Compound Name | 2-methyl-5-pyrrolidin-1-ylsulfonyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 110760491 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-methyl-5-pyrrolidin-1-ylsulfonyl-1,3-benzoxazole |
| SMILES | Cc1nc2cc(S(=O)(=O)N3CCCC3)ccc2o1 |
| InChI | InChI=1S/C12H14N2O3S/c1-9-13-11-8-10(4-5-12(11)17-9)18(15,16)14-6-2-3-7-14/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | APDOENBJULTPKL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |