C14H18N2O3S — CID 110759784
2-methyl-6-(4-methylpiperidin-1-yl)sulfonyl-1,3-benzoxazole (PubChem CID 110759784) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-methyl-6-(4-methylpiperidin-1-yl)sulfonyl-1,3-benzoxazole.
| Compound Name | 2-methyl-6-(4-methylpiperidin-1-yl)sulfonyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 110759784 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-methyl-6-(4-methylpiperidin-1-yl)sulfonyl-1,3-benzoxazole |
| SMILES | Cc1nc2ccc(S(=O)(=O)N3CCC(C)CC3)cc2o1 |
| InChI | InChI=1S/C14H18N2O3S/c1-10-5-7-16(8-6-10)20(17,18)12-3-4-13-14(9-12)19-11(2)15-13/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | MTQPSUYSZICQMI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |