C10H13NO3S — CID 105484638
3-formyl-N,N,4-trimethylbenzenesulfonamide (PubChem CID 105484638) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is 3-formyl-N,N,4-trimethylbenzenesulfonamide.
| Compound Name | 3-formyl-N,N,4-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 105484638 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 3-formyl-N,N,4-trimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1C=O |
| InChI | InChI=1S/C10H13NO3S/c1-8-4-5-10(6-9(8)7-12)15(13,14)11(2)3/h4-7H,1-3H3 |
| InChIKey | RNNLMACBCGRPEN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|