C13H17N3O4S2 — CID 139226947
3-N,3-N,6-N,6-N-tetramethylquinoline-3,6-disulfonamide (PubChem CID 139226947) has the molecular formula C13H17N3O4S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 3-N,3-N,6-N,6-N-tetramethylquinoline-3,6-disulfonamide.
| Compound Name | 3-N,3-N,6-N,6-N-tetramethylquinoline-3,6-disulfonamide |
|---|---|
| PubChem CID | 139226947 |
| Molecular Formula | C13H17N3O4S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 3-N,3-N,6-N,6-N-tetramethylquinoline-3,6-disulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2ncc(S(=O)(=O)N(C)C)cc2c1 |
| InChI | InChI=1S/C13H17N3O4S2/c1-15(2)21(17,18)11-5-6-13-10(7-11)8-12(9-14-13)22(19,20)16(3)4/h5-9H,1-4H3 |
| InChIKey | OQUONVYBPBZMIH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |