C18H17N5O4S — CID 32726076
N,N-dimethyl-3-[(quinoxaline-2-carbonylamino)carbamoyl]benzenesulfonamide (PubChem CID 32726076) has the molecular formula C18H17N5O4S and a molecular weight of 399.43 g/mol. Its IUPAC name is N,N-dimethyl-3-[(quinoxaline-2-carbonylamino)carbamoyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-3-[(quinoxaline-2-carbonylamino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 32726076 |
| Molecular Formula | C18H17N5O4S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | N,N-dimethyl-3-[(quinoxaline-2-carbonylamino)carbamoyl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)NNC(=O)c2cnc3ccccc3n2)c1 |
| InChI | InChI=1S/C18H17N5O4S/c1-23(2)28(26,27)13-7-5-6-12(10-13)17(24)21-22-18(25)16-11-19-14-8-3-4-9-15(14)20-16/h3-11H,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | JWMLLFKZRGMEOY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|