C10H9Cl2N3O2S — CID 24845953
2,3-dichloro-N,N-dimethylquinoxaline-6-sulfonamide (PubChem CID 24845953) has the molecular formula C10H9Cl2N3O2S and a molecular weight of 306.17 g/mol. Its IUPAC name is 2,3-dichloro-N,N-dimethylquinoxaline-6-sulfonamide.
| Compound Name | 2,3-dichloro-N,N-dimethylquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 24845953 |
| Molecular Formula | C10H9Cl2N3O2S |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | 2,3-dichloro-N,N-dimethylquinoxaline-6-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2nc(Cl)c(Cl)nc2c1 |
| InChI | InChI=1S/C10H9Cl2N3O2S/c1-15(2)18(16,17)6-3-4-7-8(5-6)14-10(12)9(11)13-7/h3-5H,1-2H3 |
| InChIKey | ODSUZZOFDSXGGP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |