C12H14ClN3O2S — CID 50743348
2-chloro-N,N-diethylquinoxaline-6-sulfonamide (PubChem CID 50743348) has the molecular formula C12H14ClN3O2S and a molecular weight of 299.78 g/mol. Its IUPAC name is 2-chloro-N,N-diethylquinoxaline-6-sulfonamide.
| Compound Name | 2-chloro-N,N-diethylquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 50743348 |
| Molecular Formula | C12H14ClN3O2S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-chloro-N,N-diethylquinoxaline-6-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2nc(Cl)cnc2c1 |
| InChI | InChI=1S/C12H14ClN3O2S/c1-3-16(4-2)19(17,18)9-5-6-10-11(7-9)14-8-12(13)15-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | KPAVIYLWDJHRII-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |