C23H29N5O3S — CID 50840508
N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]quinoxaline-6-sulfonamide (PubChem CID 50840508) has the molecular formula C23H29N5O3S and a molecular weight of 455.58 g/mol. Its IUPAC name is N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]quinoxaline-6-sulfonamide.
| Compound Name | N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]quinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 50840508 |
| Molecular Formula | C23H29N5O3S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]quinoxaline-6-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2nc(N3CCN(c4ccccc4OC)CC3)cnc2c1 |
| InChI | InChI=1S/C23H29N5O3S/c1-4-28(5-2)32(29,30)18-10-11-19-20(16-18)24-17-23(25-19)27-14-12-26(13-15-27)21-8-6-7-9-22(21)31-3/h6-11,16-17H,4-5,12-15H2,1-3H3 |
| InChIKey | UDLMKENFKRPNCZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |