C18H10F3NO3 — CID 88871646
4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde (PubChem CID 88871646) has the molecular formula C18H10F3NO3 and a molecular weight of 345.28 g/mol. Its IUPAC name is 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde.
| Compound Name | 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde |
|---|---|
| PubChem CID | 88871646 |
| Molecular Formula | C18H10F3NO3 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde |
| SMILES | O=Cc1c(-c2cccc(C(F)(F)F)c2)[nH]c2c(C=O)cccc2c1=O |
| InChI | InChI=1S/C18H10F3NO3/c19-18(20,21)12-5-1-3-10(7-12)15-14(9-24)17(25)13-6-2-4-11(8-23)16(13)22-15/h1-9H,(H,22,25) |
| InChIKey | ZTLRJVFBXZELPE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|