About 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde
4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde (PubChem CID 88871646) has the molecular formula C18H10F3NO3
and a molecular weight of 345.28 g/mol. Its IUPAC name is 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde.
Molecular Properties
| Compound Name | 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde |
| PubChem CID | 88871646 |
| Molecular Formula | C18H10F3NO3 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde |
| SMILES | O=Cc1c(-c2cccc(C(F)(F)F)c2)[nH]c2c(C=O)cccc2c1=O |
| InChI | InChI=1S/C18H10F3NO3/c19-18(20,21)12-5-1-3-10(7-12)15-14(9-24)17(25)13-6-2-4-11(8-23)16(13)22-15/h1-9H,(H,22,25) |
| InChIKey | ZTLRJVFBXZELPE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde?
The IUPAC name of 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde (CID 88871646) is 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde.
What is the SMILES notation for 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde?
The canonical SMILES for 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde is O=Cc1c(-c2cccc(C(F)(F)F)c2)[nH]c2c(C=O)cccc2c1=O.
What is the InChIKey of 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde?
The InChIKey is ZTLRJVFBXZELPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F3NO3/c19-18(20,21)12-5-1-3-10(7-12)15-14(9-24)17(25)13-6-2-4-11(8-23)16(13)22-15/h1-9H,(H,22,25).
What are the key properties of 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde?
4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde has a molecular weight of 345.28 g/mol, XLogP of 3.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-2-[3-(trifluoromethyl)phenyl]-1H-quinoline-3,8-dicarbaldehyde is sourced from PubChem (CID 88871646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).