C20H15F2N3O — CID 175592085
5-[(2,5-difluorophenyl)methylamino]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one (PubChem CID 175592085) has the molecular formula C20H15F2N3O and a molecular weight of 351.36 g/mol. Its IUPAC name is 5-[(2,5-difluorophenyl)methylamino]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one.
| Compound Name | 5-[(2,5-difluorophenyl)methylamino]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 175592085 |
| Molecular Formula | C20H15F2N3O |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 5-[(2,5-difluorophenyl)methylamino]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(NCc3cc(F)ccc3F)cc2C1=Cc1ccc[nH]1 |
| InChI | InChI=1S/C20H15F2N3O/c21-13-3-5-18(22)12(8-13)11-24-15-4-6-19-16(9-15)17(20(26)25-19)10-14-2-1-7-23-14/h1-10,23-24H,11H2,(H,25,26) |
| InChIKey | YZULEPZKILGFNE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|