C21H14N2O2 — CID 10268240
(3Z)-5-[2-(3-hydroxyphenyl)ethynyl]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one (PubChem CID 10268240) has the molecular formula C21H14N2O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is (3Z)-5-[2-(3-hydroxyphenyl)ethynyl]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one.
| Compound Name | (3Z)-5-[2-(3-hydroxyphenyl)ethynyl]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 10268240 |
| Molecular Formula | C21H14N2O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (3Z)-5-[2-(3-hydroxyphenyl)ethynyl]-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(C#Cc3cccc(O)c3)cc2/C1=C/c1ccc[nH]1 |
| InChI | InChI=1S/C21H14N2O2/c24-17-5-1-3-14(11-17)6-7-15-8-9-20-18(12-15)19(21(25)23-20)13-16-4-2-10-22-16/h1-5,8-13,22,24H,(H,23,25)/b19-13- |
| InChIKey | UMVXEEDGNPDOFC-UYRXBGFRSA-N |
| XLogP | 3.61 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|