C14H13N5O — CID 57110227
2-[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-5-yl]guanidine (PubChem CID 57110227) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-5-yl]guanidine.
| Compound Name | 2-[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-5-yl]guanidine |
|---|---|
| PubChem CID | 57110227 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-5-yl]guanidine |
| SMILES | NC(N)=Nc1ccc2c(c1)C(=Cc1ccc[nH]1)C(=O)N2 |
| InChI | InChI=1S/C14H13N5O/c15-14(16)18-9-3-4-12-10(7-9)11(13(20)19-12)6-8-2-1-5-17-8/h1-7,17H,(H,19,20)(H4,15,16,18) |
| InChIKey | CMVXJNGFNDMRGF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|