C14H12N4O2 — CID 141140540
[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]urea (PubChem CID 141140540) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is [2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]urea.
| Compound Name | [2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]urea |
|---|---|
| PubChem CID | 141140540 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | [2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]urea |
| SMILES | NC(=O)Nc1ccc2c(c1)NC(=O)C2=Cc1ccc[nH]1 |
| InChI | InChI=1S/C14H12N4O2/c15-14(20)17-9-3-4-10-11(6-8-2-1-5-16-8)13(19)18-12(10)7-9/h1-7,16H,(H,18,19)(H3,15,17,20) |
| InChIKey | VMMOGFZXZNTQHI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|