C27H19ClF3N5O2 — CID 59397203
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea (PubChem CID 59397203) has the molecular formula C27H19ClF3N5O2 and a molecular weight of 537.93 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 59397203 |
| Molecular Formula | C27H19ClF3N5O2 |
| Molecular Weight | 537.93 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-[[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea |
| SMILES | O=C(Nc1cccc(Nc2ccc3c(c2)NC(=O)/C3=C\c2ccc[nH]2)c1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H19ClF3N5O2/c28-23-9-7-18(13-22(23)27(29,30)31)35-26(38)34-17-4-1-3-16(11-17)33-19-6-8-20-21(12-15-5-2-10-32-15)25(37)36-24(20)14-19/h1-14,32-33H,(H,36,37)(H2,34,35,38)/b21-12- |
| InChIKey | OOQRNWUXLWSYJX-MTJSOVHGSA-N |
| XLogP | 7.57 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.93 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|