C27H21Cl2N5O2 — CID 24959795
1-(2,5-dichlorophenyl)-3-[4-methyl-3-[[(3E)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea (PubChem CID 24959795) has the molecular formula C27H21Cl2N5O2 and a molecular weight of 518.40 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[4-methyl-3-[[(3E)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[4-methyl-3-[[(3E)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 24959795 |
| Molecular Formula | C27H21Cl2N5O2 |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[4-methyl-3-[[(3E)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc(Cl)ccc2Cl)cc1Nc1ccc2c(c1)NC(=O)/C2=C/c1ccc[nH]1 |
| InChI | InChI=1S/C27H21Cl2N5O2/c1-15-4-6-19(32-27(36)34-25-11-16(28)5-9-22(25)29)13-23(15)31-18-7-8-20-21(12-17-3-2-10-30-17)26(35)33-24(20)14-18/h2-14,30-31H,1H3,(H,33,35)(H2,32,34,36)/b21-12+ |
| InChIKey | ZGJQRCTZTZMMTB-CIAFOILYSA-N |
| XLogP | 7.51 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|