C27H21F2N5O2 — CID 24957586
1-(3,4-difluorophenyl)-3-[4-methyl-3-[[(3E)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea (PubChem CID 24957586) has the molecular formula C27H21F2N5O2 and a molecular weight of 485.49 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[4-methyl-3-[[(3E)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[4-methyl-3-[[(3E)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 24957586 |
| Molecular Formula | C27H21F2N5O2 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[4-methyl-3-[[(3E)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(F)c(F)c2)cc1Nc1ccc2c(c1)NC(=O)/C2=C/c1ccc[nH]1 |
| InChI | InChI=1S/C27H21F2N5O2/c1-15-4-5-19(33-27(36)32-17-7-9-22(28)23(29)12-17)13-24(15)31-18-6-8-20-21(11-16-3-2-10-30-16)26(35)34-25(20)14-18/h2-14,30-31H,1H3,(H,34,35)(H2,32,33,36)/b21-11+ |
| InChIKey | ODLCXECMIRZHDE-SRZZPIQSSA-N |
| XLogP | 6.48 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|