C26H18F3N5O2 — CID 24962357
1-[3-[[(3E)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]-3-(2,3,4-trifluorophenyl)urea (PubChem CID 24962357) has the molecular formula C26H18F3N5O2 and a molecular weight of 489.46 g/mol. Its IUPAC name is 1-[3-[[(3E)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-[3-[[(3E)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 24962357 |
| Molecular Formula | C26H18F3N5O2 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 1-[3-[[(3E)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]-3-(2,3,4-trifluorophenyl)urea |
| SMILES | O=C(Nc1cccc(Nc2ccc3c(c2)NC(=O)/C3=C/c2ccc[nH]2)c1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C26H18F3N5O2/c27-20-8-9-21(24(29)23(20)28)34-26(36)32-16-4-1-3-15(11-16)31-17-6-7-18-19(12-14-5-2-10-30-14)25(35)33-22(18)13-17/h1-13,30-31H,(H,33,35)(H2,32,34,36)/b19-12+ |
| InChIKey | IUYDLNGUEJKHFD-XDHOZWIPSA-N |
| XLogP | 6.31 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|