C28H19F3N6O2 — CID 59397061
1-[3-cyano-5-[[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 59397061) has the molecular formula C28H19F3N6O2 and a molecular weight of 528.49 g/mol. Its IUPAC name is 1-[3-cyano-5-[[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-cyano-5-[[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 59397061 |
| Molecular Formula | C28H19F3N6O2 |
| Molecular Weight | 528.49 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 1-[3-cyano-5-[[(3Z)-2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | N#Cc1cc(NC(=O)Nc2cccc(C(F)(F)F)c2)cc(Nc2ccc3c(c2)NC(=O)/C3=C\c2ccc[nH]2)c1 |
| InChI | InChI=1S/C28H19F3N6O2/c29-28(30,31)17-3-1-4-19(11-17)35-27(39)36-22-10-16(15-32)9-21(12-22)34-20-6-7-23-24(13-18-5-2-8-33-18)26(38)37-25(23)14-20/h1-14,33-34H,(H,37,38)(H2,35,36,39)/b24-13- |
| InChIKey | ILFFSHLERAISEY-CFRMEGHHSA-N |
| XLogP | 6.79 |
| TPSA | 121.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.49 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|