C24H19F3N6O2 — CID 143694376
1-[3-[[(3Z)-3-(2-amino-2-iminoethylidene)-2-oxo-1H-indol-6-yl]amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 143694376) has the molecular formula C24H19F3N6O2 and a molecular weight of 480.45 g/mol. Its IUPAC name is 1-[3-[[(3Z)-3-(2-amino-2-iminoethylidene)-2-oxo-1H-indol-6-yl]amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[[(3Z)-3-(2-amino-2-iminoethylidene)-2-oxo-1H-indol-6-yl]amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 143694376 |
| Molecular Formula | C24H19F3N6O2 |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 1-[3-[[(3Z)-3-(2-amino-2-iminoethylidene)-2-oxo-1H-indol-6-yl]amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | [H]/N=C(N)/C=C1\C(=O)Nc2cc(Nc3cccc(NC(=O)Nc4cccc(C(F)(F)F)c4)c3)ccc21 |
| InChI | InChI=1S/C24H19F3N6O2/c25-24(26,27)13-3-1-4-14(9-13)31-23(35)32-16-6-2-5-15(10-16)30-17-7-8-18-19(12-21(28)29)22(34)33-20(18)11-17/h1-12,30H,(H3,28,29)(H,33,34)(H2,31,32,35)/b19-12- |
| InChIKey | PNEZGQBSARKCKT-UNOMPAQXSA-N |
| XLogP | 5.36 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|