C26H21FN6O2 — CID 24961269
1-(4-fluorophenyl)-3-[3-[[(3E)-3-[(5-methyl-1H-imidazol-4-yl)methylidene]-2-oxo-1H-indol-6-yl]amino]phenyl]urea (PubChem CID 24961269) has the molecular formula C26H21FN6O2 and a molecular weight of 468.49 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[3-[[(3E)-3-[(5-methyl-1H-imidazol-4-yl)methylidene]-2-oxo-1H-indol-6-yl]amino]phenyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[3-[[(3E)-3-[(5-methyl-1H-imidazol-4-yl)methylidene]-2-oxo-1H-indol-6-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 24961269 |
| Molecular Formula | C26H21FN6O2 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[3-[[(3E)-3-[(5-methyl-1H-imidazol-4-yl)methylidene]-2-oxo-1H-indol-6-yl]amino]phenyl]urea |
| SMILES | Cc1[nH]cnc1/C=C1/C(=O)Nc2cc(Nc3cccc(NC(=O)Nc4ccc(F)cc4)c3)ccc21 |
| InChI | InChI=1S/C26H21FN6O2/c1-15-23(29-14-28-15)13-22-21-10-9-20(12-24(21)33-25(22)34)30-18-3-2-4-19(11-18)32-26(35)31-17-7-5-16(27)6-8-17/h2-14,30H,1H3,(H,28,29)(H,33,34)(H2,31,32,35)/b22-13+ |
| InChIKey | GDSRECSAQWOOSU-LPYMAVHISA-N |
| XLogP | 5.74 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|