C21H19N5O2 — CID 154512244
[4-methyl-3-[[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea (PubChem CID 154512244) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is [4-methyl-3-[[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea.
| Compound Name | [4-methyl-3-[[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 154512244 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | [4-methyl-3-[[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]amino]phenyl]urea |
| SMILES | Cc1ccc(NC(N)=O)cc1Nc1ccc2c(c1)NC(=O)C2=Cc1ccc[nH]1 |
| InChI | InChI=1S/C21H19N5O2/c1-12-4-5-15(25-21(22)28)10-18(12)24-14-6-7-16-17(9-13-3-2-8-23-13)20(27)26-19(16)11-14/h2-11,23-24H,1H3,(H,26,27)(H3,22,25,28) |
| InChIKey | GNPBFGYAEXESQN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|