C23H22N4O2 — CID 143694320
N-[4-methyl-3-[[(3Z)-3-[(4-methyl-1H-pyrrol-2-yl)methylidene]-2-oxo-1H-indol-6-yl]amino]phenyl]acetamide (PubChem CID 143694320) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[4-methyl-3-[[(3Z)-3-[(4-methyl-1H-pyrrol-2-yl)methylidene]-2-oxo-1H-indol-6-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-methyl-3-[[(3Z)-3-[(4-methyl-1H-pyrrol-2-yl)methylidene]-2-oxo-1H-indol-6-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 143694320 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[4-methyl-3-[[(3Z)-3-[(4-methyl-1H-pyrrol-2-yl)methylidene]-2-oxo-1H-indol-6-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C)c(Nc2ccc3c(c2)NC(=O)/C3=C\c2cc(C)c[nH]2)c1 |
| InChI | InChI=1S/C23H22N4O2/c1-13-8-18(24-12-13)9-20-19-7-6-17(11-22(19)27-23(20)29)26-21-10-16(25-15(3)28)5-4-14(21)2/h4-12,24,26H,1-3H3,(H,25,28)(H,27,29)/b20-9- |
| InChIKey | LDYHYVGSZJNGLO-UKWGHVSLSA-N |
| XLogP | 4.83 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|