C23H15N3O4 — CID 24950374
(3E)-5-hydroxy-3-[[6-[(E)-(5-hydroxy-2-oxo-1H-indol-3-ylidene)methyl]-2-pyridinyl]methylidene]-1H-indol-2-one (PubChem CID 24950374) has the molecular formula C23H15N3O4 and a molecular weight of 397.39 g/mol. Its IUPAC name is (3E)-5-hydroxy-3-[[6-[(E)-(5-hydroxy-2-oxo-1H-indol-3-ylidene)methyl]-2-pyridinyl]methylidene]-1H-indol-2-one.
| Compound Name | (3E)-5-hydroxy-3-[[6-[(E)-(5-hydroxy-2-oxo-1H-indol-3-ylidene)methyl]-2-pyridinyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 24950374 |
| Molecular Formula | C23H15N3O4 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (3E)-5-hydroxy-3-[[6-[(E)-(5-hydroxy-2-oxo-1H-indol-3-ylidene)methyl]-2-pyridinyl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(O)cc2/C1=C\c1cccc(/C=C2/C(=O)Nc3ccc(O)cc32)n1 |
| InChI | InChI=1S/C23H15N3O4/c27-14-4-6-20-16(10-14)18(22(29)25-20)8-12-2-1-3-13(24-12)9-19-17-11-15(28)5-7-21(17)26-23(19)30/h1-11,27-28H,(H,25,29)(H,26,30)/b18-8+,19-9+ |
| InChIKey | NQBKKJMYDBWXCZ-GCBPPVMSSA-N |
| XLogP | 3.48 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|