C15H10ClN3O2S — CID 5473336
(3E)-3-[(6-chloro-2-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-5-hydroxy-1H-indol-2-one (PubChem CID 5473336) has the molecular formula C15H10ClN3O2S and a molecular weight of 331.78 g/mol. Its IUPAC name is (3E)-3-[(6-chloro-2-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-5-hydroxy-1H-indol-2-one.
| Compound Name | (3E)-3-[(6-chloro-2-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-5-hydroxy-1H-indol-2-one |
|---|---|
| PubChem CID | 5473336 |
| Molecular Formula | C15H10ClN3O2S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | (3E)-3-[(6-chloro-2-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-5-hydroxy-1H-indol-2-one |
| SMILES | Cc1cn2c(/C=C3/C(=O)Nc4ccc(O)cc43)c(Cl)nc2s1 |
| InChI | InChI=1S/C15H10ClN3O2S/c1-7-6-19-12(13(16)18-15(19)22-7)5-10-9-4-8(20)2-3-11(9)17-14(10)21/h2-6,20H,1H3,(H,17,21)/b10-5+ |
| InChIKey | GHSMUEUWQPHYLS-BJMVGYQFSA-N |
| XLogP | 3.56 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|