C17H15NO3S — CID 54489209
3-[3-[(5-methylthiophen-2-yl)methylidene]-2-oxo-1H-indol-5-yl]propanoic acid (PubChem CID 54489209) has the molecular formula C17H15NO3S and a molecular weight of 313.38 g/mol. Its IUPAC name is 3-[3-[(5-methylthiophen-2-yl)methylidene]-2-oxo-1H-indol-5-yl]propanoic acid.
| Compound Name | 3-[3-[(5-methylthiophen-2-yl)methylidene]-2-oxo-1H-indol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 54489209 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 3-[3-[(5-methylthiophen-2-yl)methylidene]-2-oxo-1H-indol-5-yl]propanoic acid |
| SMILES | Cc1ccc(C=C2C(=O)Nc3ccc(CCC(=O)O)cc32)s1 |
| InChI | InChI=1S/C17H15NO3S/c1-10-2-5-12(22-10)9-14-13-8-11(4-7-16(19)20)3-6-15(13)18-17(14)21/h2-3,5-6,8-9H,4,7H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | XUNMZUWLKZNXNJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|