C15H11Cl2NOS — CID 57189107
5-(2-chloroethyl)-3-[(5-chlorothiophen-2-yl)methylidene]-1H-indol-2-one (PubChem CID 57189107) has the molecular formula C15H11Cl2NOS and a molecular weight of 324.23 g/mol. Its IUPAC name is 5-(2-chloroethyl)-3-[(5-chlorothiophen-2-yl)methylidene]-1H-indol-2-one.
| Compound Name | 5-(2-chloroethyl)-3-[(5-chlorothiophen-2-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57189107 |
| Molecular Formula | C15H11Cl2NOS |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | 5-(2-chloroethyl)-3-[(5-chlorothiophen-2-yl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(CCCl)cc2C1=Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C15H11Cl2NOS/c16-6-5-9-1-3-13-11(7-9)12(15(19)18-13)8-10-2-4-14(17)20-10/h1-4,7-8H,5-6H2,(H,18,19) |
| InChIKey | BQJFBDIQOABIPW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|