C17H12ClF2NO — CID 57048256
5-(2-chloroethyl)-3-[(3,5-difluorophenyl)methylidene]-1H-indol-2-one (PubChem CID 57048256) has the molecular formula C17H12ClF2NO and a molecular weight of 319.74 g/mol. Its IUPAC name is 5-(2-chloroethyl)-3-[(3,5-difluorophenyl)methylidene]-1H-indol-2-one.
| Compound Name | 5-(2-chloroethyl)-3-[(3,5-difluorophenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57048256 |
| Molecular Formula | C17H12ClF2NO |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 5-(2-chloroethyl)-3-[(3,5-difluorophenyl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(CCCl)cc2C1=Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H12ClF2NO/c18-4-3-10-1-2-16-14(7-10)15(17(22)21-16)8-11-5-12(19)9-13(20)6-11/h1-2,5-9H,3-4H2,(H,21,22) |
| InChIKey | OGAFDDSVIQELPO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|