C19H18ClNO — CID 57001674
5-(2-chloroethyl)-3-[(4-ethylphenyl)methylidene]-1H-indol-2-one (PubChem CID 57001674) has the molecular formula C19H18ClNO and a molecular weight of 311.81 g/mol. Its IUPAC name is 5-(2-chloroethyl)-3-[(4-ethylphenyl)methylidene]-1H-indol-2-one.
| Compound Name | 5-(2-chloroethyl)-3-[(4-ethylphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57001674 |
| Molecular Formula | C19H18ClNO |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 5-(2-chloroethyl)-3-[(4-ethylphenyl)methylidene]-1H-indol-2-one |
| SMILES | CCc1ccc(C=C2C(=O)Nc3ccc(CCCl)cc32)cc1 |
| InChI | InChI=1S/C19H18ClNO/c1-2-13-3-5-14(6-4-13)12-17-16-11-15(9-10-20)7-8-18(16)21-19(17)22/h3-8,11-12H,2,9-10H2,1H3,(H,21,22) |
| InChIKey | TUBZRXFISCTVDX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|