C21H20N2O5 — CID 57065805
2-[[5-(2-carboxyethyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-1H-indole-3-carboxylic acid (PubChem CID 57065805) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-[[5-(2-carboxyethyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-1H-indole-3-carboxylic acid.
| Compound Name | 2-[[5-(2-carboxyethyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-1H-indole-3-carboxylic acid |
|---|---|
| PubChem CID | 57065805 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-[[5-(2-carboxyethyl)-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-1H-indole-3-carboxylic acid |
| SMILES | O=C(O)CCc1ccc2c(c1)C(=Cc1[nH]c3c(c1C(=O)O)CCCC3)C(=O)N2 |
| InChI | InChI=1S/C21H20N2O5/c24-18(25)8-6-11-5-7-16-13(9-11)14(20(26)23-16)10-17-19(21(27)28)12-3-1-2-4-15(12)22-17/h5,7,9-10,22H,1-4,6,8H2,(H,23,26)(H,24,25)(H,27,28) |
| InChIKey | QCYDFBSWHWTYKM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|