C18H15ClN2O5 — CID 54419574
4-(2-carboxyethyl)-5-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2-carboxylic acid (PubChem CID 54419574) has the molecular formula C18H15ClN2O5 and a molecular weight of 374.78 g/mol. Its IUPAC name is 4-(2-carboxyethyl)-5-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-(2-carboxyethyl)-5-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 54419574 |
| Molecular Formula | C18H15ClN2O5 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 4-(2-carboxyethyl)-5-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-3-methyl-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)[nH]c(C=C2C(=O)Nc3ccc(Cl)cc32)c1CCC(=O)O |
| InChI | InChI=1S/C18H15ClN2O5/c1-8-10(3-5-15(22)23)14(20-16(8)18(25)26)7-12-11-6-9(19)2-4-13(11)21-17(12)24/h2,4,6-7,20H,3,5H2,1H3,(H,21,24)(H,22,23)(H,25,26) |
| InChIKey | VZVJJLXDLLLWKK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|