C28H28ClN3O4 — CID 123234804
3-[5-[[5-[1-(3-chlorophenyl)propylcarbamoyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrol-3-yl]propanoic acid (PubChem CID 123234804) has the molecular formula C28H28ClN3O4 and a molecular weight of 506.00 g/mol. Its IUPAC name is 3-[5-[[5-[1-(3-chlorophenyl)propylcarbamoyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrol-3-yl]propanoic acid.
| Compound Name | 3-[5-[[5-[1-(3-chlorophenyl)propylcarbamoyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 123234804 |
| Molecular Formula | C28H28ClN3O4 |
| Molecular Weight | 506.00 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 3-[5-[[5-[1-(3-chlorophenyl)propylcarbamoyl]-2-oxo-1H-indol-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrol-3-yl]propanoic acid |
| SMILES | CCC(NC(=O)c1ccc2c(c1)C(=Cc1[nH]c(C)c(CCC(=O)O)c1C)C(=O)N2)c1cccc(Cl)c1 |
| InChI | InChI=1S/C28H28ClN3O4/c1-4-23(17-6-5-7-19(29)12-17)31-27(35)18-8-10-24-21(13-18)22(28(36)32-24)14-25-15(2)20(16(3)30-25)9-11-26(33)34/h5-8,10,12-14,23,30H,4,9,11H2,1-3H3,(H,31,35)(H,32,36)(H,33,34) |
| InChIKey | BPZMZPGUONWDKM-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.00 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|