C16H15N3O3 — CID 57143605
4-ethyl-3-methyl-5-[(2-oxo-1H-pyrrolo[3,2-c]pyridin-3-ylidene)methyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 57143605) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-ethyl-3-methyl-5-[(2-oxo-1H-pyrrolo[3,2-c]pyridin-3-ylidene)methyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-ethyl-3-methyl-5-[(2-oxo-1H-pyrrolo[3,2-c]pyridin-3-ylidene)methyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 57143605 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-ethyl-3-methyl-5-[(2-oxo-1H-pyrrolo[3,2-c]pyridin-3-ylidene)methyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | CCc1c(C=C2C(=O)Nc3ccncc32)[nH]c(C(=O)O)c1C |
| InChI | InChI=1S/C16H15N3O3/c1-3-9-8(2)14(16(21)22)18-13(9)6-10-11-7-17-5-4-12(11)19-15(10)20/h4-7,18H,3H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | KSUSBXLXIFCCQR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|