C12H7BrN2OS — CID 57206581
3-[(3-bromothiophen-2-yl)methylidene]-1H-pyrrolo[3,2-c]pyridin-2-one (PubChem CID 57206581) has the molecular formula C12H7BrN2OS and a molecular weight of 307.17 g/mol. Its IUPAC name is 3-[(3-bromothiophen-2-yl)methylidene]-1H-pyrrolo[3,2-c]pyridin-2-one.
| Compound Name | 3-[(3-bromothiophen-2-yl)methylidene]-1H-pyrrolo[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 57206581 |
| Molecular Formula | C12H7BrN2OS |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | 3-[(3-bromothiophen-2-yl)methylidene]-1H-pyrrolo[3,2-c]pyridin-2-one |
| SMILES | O=C1Nc2ccncc2C1=Cc1sccc1Br |
| InChI | InChI=1S/C12H7BrN2OS/c13-9-2-4-17-11(9)5-7-8-6-14-3-1-10(8)15-12(7)16/h1-6H,(H,15,16) |
| InChIKey | AOCOHFMZEALLDC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|