C14H12NO5PS — CID 57259497
[3-[(3-methylthiophen-2-yl)methylidene]-2-oxo-1H-indol-5-yl] dihydrogen phosphate (PubChem CID 57259497) has the molecular formula C14H12NO5PS and a molecular weight of 337.29 g/mol. Its IUPAC name is [3-[(3-methylthiophen-2-yl)methylidene]-2-oxo-1H-indol-5-yl] dihydrogen phosphate.
| Compound Name | [3-[(3-methylthiophen-2-yl)methylidene]-2-oxo-1H-indol-5-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 57259497 |
| Molecular Formula | C14H12NO5PS |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | [3-[(3-methylthiophen-2-yl)methylidene]-2-oxo-1H-indol-5-yl] dihydrogen phosphate |
| SMILES | Cc1ccsc1C=C1C(=O)Nc2ccc(OP(=O)(O)O)cc21 |
| InChI | InChI=1S/C14H12NO5PS/c1-8-4-5-22-13(8)7-11-10-6-9(20-21(17,18)19)2-3-12(10)15-14(11)16/h2-7H,1H3,(H,15,16)(H2,17,18,19) |
| InChIKey | FHKSRGCTNCJECN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|