C18H21N3O — CID 57166711
3-[[3,5-di(propan-2-yl)-1H-pyrrol-2-yl]methylidene]-1H-pyrrolo[3,2-c]pyridin-2-one (PubChem CID 57166711) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is 3-[[3,5-di(propan-2-yl)-1H-pyrrol-2-yl]methylidene]-1H-pyrrolo[3,2-c]pyridin-2-one.
| Compound Name | 3-[[3,5-di(propan-2-yl)-1H-pyrrol-2-yl]methylidene]-1H-pyrrolo[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 57166711 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 3-[[3,5-di(propan-2-yl)-1H-pyrrol-2-yl]methylidene]-1H-pyrrolo[3,2-c]pyridin-2-one |
| SMILES | CC(C)c1cc(C(C)C)c(C=C2C(=O)Nc3ccncc32)[nH]1 |
| InChI | InChI=1S/C18H21N3O/c1-10(2)12-7-16(11(3)4)20-17(12)8-13-14-9-19-6-5-15(14)21-18(13)22/h5-11,20H,1-4H3,(H,21,22) |
| InChIKey | PFAVUOYHXMRPKT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|