C12H8BrN3OS — CID 57261752
5-amino-3-[(3-bromothiophen-2-yl)methylidene]-1H-pyrrolo[2,3-b]pyridin-2-one (PubChem CID 57261752) has the molecular formula C12H8BrN3OS and a molecular weight of 322.19 g/mol. Its IUPAC name is 5-amino-3-[(3-bromothiophen-2-yl)methylidene]-1H-pyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 5-amino-3-[(3-bromothiophen-2-yl)methylidene]-1H-pyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 57261752 |
| Molecular Formula | C12H8BrN3OS |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 5-amino-3-[(3-bromothiophen-2-yl)methylidene]-1H-pyrrolo[2,3-b]pyridin-2-one |
| SMILES | Nc1cnc2c(c1)C(=Cc1sccc1Br)C(=O)N2 |
| InChI | InChI=1S/C12H8BrN3OS/c13-9-1-2-18-10(9)4-8-7-3-6(14)5-15-11(7)16-12(8)17/h1-5H,14H2,(H,15,16,17) |
| InChIKey | STKCLIWYQCBMRV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|