C18H10Br2N2O2S — CID 67559789
(3E)-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridin-2-one (PubChem CID 67559789) has the molecular formula C18H10Br2N2O2S and a molecular weight of 478.17 g/mol. Its IUPAC name is (3E)-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridin-2-one.
| Compound Name | (3E)-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 67559789 |
| Molecular Formula | C18H10Br2N2O2S |
| Molecular Weight | 478.17 g/mol |
| Exact Mass | 475.88 |
| IUPAC Name | (3E)-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridin-2-one |
| SMILES | O=C1Nc2ncc(-c3ccsc3)cc2/C1=C\c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C18H10Br2N2O2S/c19-14-4-9(5-15(20)16(14)23)3-13-12-6-11(10-1-2-25-8-10)7-21-17(12)22-18(13)24/h1-8,23H,(H,21,22,24)/b13-3+ |
| InChIKey | WZSMCINPCGIART-QLKAYGNNSA-N |
| XLogP | 5.53 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.17 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|