C22H19N3O4 — CID 66779255
(3E)-3-(pyridin-3-ylmethylidene)-5-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-one (PubChem CID 66779255) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is (3E)-3-(pyridin-3-ylmethylidene)-5-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-one.
| Compound Name | (3E)-3-(pyridin-3-ylmethylidene)-5-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 66779255 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (3E)-3-(pyridin-3-ylmethylidene)-5-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-one |
| SMILES | COc1cc(-c2cnc3c(c2)/C(=C\c2cccnc2)C(=O)N3)cc(OC)c1OC |
| InChI | InChI=1S/C22H19N3O4/c1-27-18-9-14(10-19(28-2)20(18)29-3)15-8-16-17(7-13-5-4-6-23-11-13)22(26)25-21(16)24-12-15/h4-12H,1-3H3,(H,24,25,26)/b17-7+ |
| InChIKey | SJQKLWBZTHZVPG-REZTVBANSA-N |
| XLogP | 3.66 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|