C24H21N3O5 — CID 46235884
3-[(Z)-[2-oxo-5-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-ylidene]methyl]benzamide (PubChem CID 46235884) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is 3-[(Z)-[2-oxo-5-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-ylidene]methyl]benzamide.
| Compound Name | 3-[(Z)-[2-oxo-5-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 46235884 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 3-[(Z)-[2-oxo-5-(3,4,5-trimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-3-ylidene]methyl]benzamide |
| SMILES | COc1cc(-c2cnc3c(c2)/C(=C/c2cccc(C(N)=O)c2)C(=O)N3)cc(OC)c1OC |
| InChI | InChI=1S/C24H21N3O5/c1-30-19-10-15(11-20(31-2)21(19)32-3)16-9-17-18(24(29)27-23(17)26-12-16)8-13-5-4-6-14(7-13)22(25)28/h4-12H,1-3H3,(H2,25,28)(H,26,27,29)/b18-8- |
| InChIKey | BODYCSYFOVDCON-LSCVHKIXSA-N |
| XLogP | 3.37 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|