C18H10Cl2N2O3 — CID 67559830
(3E)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-(furan-2-yl)-1H-pyrrolo[2,3-b]pyridin-2-one (PubChem CID 67559830) has the molecular formula C18H10Cl2N2O3 and a molecular weight of 373.20 g/mol. Its IUPAC name is (3E)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-(furan-2-yl)-1H-pyrrolo[2,3-b]pyridin-2-one.
| Compound Name | (3E)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-(furan-2-yl)-1H-pyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 67559830 |
| Molecular Formula | C18H10Cl2N2O3 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | (3E)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-(furan-2-yl)-1H-pyrrolo[2,3-b]pyridin-2-one |
| SMILES | O=C1Nc2ncc(-c3ccco3)cc2/C1=C\c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C18H10Cl2N2O3/c19-13-5-9(6-14(20)16(13)23)4-12-11-7-10(15-2-1-3-25-15)8-21-17(11)22-18(12)24/h1-8,23H,(H,21,22,24)/b12-4+ |
| InChIKey | MNEOOEOBKBASOG-UUILKARUSA-N |
| XLogP | 4.85 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|