C17H10Cl3NO3 — CID 87889831
(3Z)-5-(2-chloroacetyl)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 87889831) has the molecular formula C17H10Cl3NO3 and a molecular weight of 382.63 g/mol. Its IUPAC name is (3Z)-5-(2-chloroacetyl)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5-(2-chloroacetyl)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 87889831 |
| Molecular Formula | C17H10Cl3NO3 |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | (3Z)-5-(2-chloroacetyl)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(C(=O)CCl)cc2/C1=C/c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C17H10Cl3NO3/c18-7-15(22)9-1-2-14-10(6-9)11(17(24)21-14)3-8-4-12(19)16(23)13(20)5-8/h1-6,23H,7H2,(H,21,24)/b11-3- |
| InChIKey | FMFVFFIKLATEES-JYOAFUTRSA-N |
| XLogP | 4.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|