C21H11Br2Cl2NO2 — CID 54524274
3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-(2,4-dichlorophenyl)-1H-indol-2-one (PubChem CID 54524274) has the molecular formula C21H11Br2Cl2NO2 and a molecular weight of 540.04 g/mol. Its IUPAC name is 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-(2,4-dichlorophenyl)-1H-indol-2-one.
| Compound Name | 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-(2,4-dichlorophenyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 54524274 |
| Molecular Formula | C21H11Br2Cl2NO2 |
| Molecular Weight | 540.04 g/mol |
| Exact Mass | 536.85 |
| IUPAC Name | 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-(2,4-dichlorophenyl)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(-c3ccc(Cl)cc3Cl)cc2C1=Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C21H11Br2Cl2NO2/c22-16-6-10(7-17(23)20(16)27)5-15-14-8-11(1-4-19(14)26-21(15)28)13-3-2-12(24)9-18(13)25/h1-9,27H,(H,26,28) |
| InChIKey | YRZYXBZFKYTPCU-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.04 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|