C24H15Br2N3O2S — CID 87889913
(3Z)-5-(2-anilino-1,3-thiazol-4-yl)-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 87889913) has the molecular formula C24H15Br2N3O2S and a molecular weight of 569.28 g/mol. Its IUPAC name is (3Z)-5-(2-anilino-1,3-thiazol-4-yl)-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5-(2-anilino-1,3-thiazol-4-yl)-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 87889913 |
| Molecular Formula | C24H15Br2N3O2S |
| Molecular Weight | 569.28 g/mol |
| Exact Mass | 566.93 |
| IUPAC Name | (3Z)-5-(2-anilino-1,3-thiazol-4-yl)-3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(-c3csc(Nc4ccccc4)n3)cc2/C1=C/c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C24H15Br2N3O2S/c25-18-9-13(10-19(26)22(18)30)8-17-16-11-14(6-7-20(16)28-23(17)31)21-12-32-24(29-21)27-15-4-2-1-3-5-15/h1-12,30H,(H,27,29)(H,28,31)/b17-8- |
| InChIKey | ZXMBNRIKXMOJRV-IUXPMGMMSA-N |
| XLogP | 7.28 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.28 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|