C19H14ClN3O2S — CID 173184717
3-[(3-chloro-4-hydroxyphenyl)methylidene]-5-[2-(methylamino)-1,3-thiazol-4-yl]-1H-indol-2-one (PubChem CID 173184717) has the molecular formula C19H14ClN3O2S and a molecular weight of 383.86 g/mol. Its IUPAC name is 3-[(3-chloro-4-hydroxyphenyl)methylidene]-5-[2-(methylamino)-1,3-thiazol-4-yl]-1H-indol-2-one.
| Compound Name | 3-[(3-chloro-4-hydroxyphenyl)methylidene]-5-[2-(methylamino)-1,3-thiazol-4-yl]-1H-indol-2-one |
|---|---|
| PubChem CID | 173184717 |
| Molecular Formula | C19H14ClN3O2S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 3-[(3-chloro-4-hydroxyphenyl)methylidene]-5-[2-(methylamino)-1,3-thiazol-4-yl]-1H-indol-2-one |
| SMILES | CNc1nc(-c2ccc3c(c2)C(=Cc2ccc(O)c(Cl)c2)C(=O)N3)cs1 |
| InChI | InChI=1S/C19H14ClN3O2S/c1-21-19-23-16(9-26-19)11-3-4-15-12(8-11)13(18(25)22-15)6-10-2-5-17(24)14(20)7-10/h2-9,24H,1H3,(H,21,23)(H,22,25) |
| InChIKey | MJAQBQBHRKRKKT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|