C19H11Br2NO2S — CID 54457732
3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-thiophen-3-yl-1H-indol-2-one (PubChem CID 54457732) has the molecular formula C19H11Br2NO2S and a molecular weight of 477.18 g/mol. Its IUPAC name is 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-thiophen-3-yl-1H-indol-2-one.
| Compound Name | 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-thiophen-3-yl-1H-indol-2-one |
|---|---|
| PubChem CID | 54457732 |
| Molecular Formula | C19H11Br2NO2S |
| Molecular Weight | 477.18 g/mol |
| Exact Mass | 474.89 |
| IUPAC Name | 3-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-5-thiophen-3-yl-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(-c3ccsc3)cc2C1=Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C19H11Br2NO2S/c20-15-6-10(7-16(21)18(15)23)5-14-13-8-11(12-3-4-25-9-12)1-2-17(13)22-19(14)24/h1-9,23H,(H,22,24) |
| InChIKey | WZKJAEBUHAPYPE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.18 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|