C15H8Br2N4O2 — CID 135581576
(8E)-8-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-2,6-dihydropyrrolo[3,2-e]benzotriazol-7-one (PubChem CID 135581576) has the molecular formula C15H8Br2N4O2 and a molecular weight of 436.06 g/mol. Its IUPAC name is (8E)-8-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-2,6-dihydropyrrolo[3,2-e]benzotriazol-7-one.
| Compound Name | (8E)-8-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-2,6-dihydropyrrolo[3,2-e]benzotriazol-7-one |
|---|---|
| PubChem CID | 135581576 |
| Molecular Formula | C15H8Br2N4O2 |
| Molecular Weight | 436.06 g/mol |
| Exact Mass | 433.90 |
| IUPAC Name | (8E)-8-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-2,6-dihydropyrrolo[3,2-e]benzotriazol-7-one |
| SMILES | O=C1Nc2ccc3n[nH]nc3c2/C1=C\c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C15H8Br2N4O2/c16-8-4-6(5-9(17)14(8)22)3-7-12-10(18-15(7)23)1-2-11-13(12)20-21-19-11/h1-5,22H,(H,18,23)(H,19,20,21)/b7-3+ |
| InChIKey | MQVZFDLJCXFLFC-XVNBXDOJSA-N |
| XLogP | 3.68 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.06 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|