C10H6Br2N2O3 — CID 78472496
5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 78472496) has the molecular formula C10H6Br2N2O3 and a molecular weight of 361.98 g/mol. Its IUPAC name is 5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | 5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 78472496 |
| Molecular Formula | C10H6Br2N2O3 |
| Molecular Weight | 361.98 g/mol |
| Exact Mass | 359.87 |
| IUPAC Name | 5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2cc(Br)c(O)c(Br)c2)N1 |
| InChI | InChI=1S/C10H6Br2N2O3/c11-5-1-4(2-6(12)8(5)15)3-7-9(16)14-10(17)13-7/h1-3,15H,(H2,13,14,16,17) |
| InChIKey | YKWXNFDWIXFYKS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.98 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|