C11H8Br2N2O3 — CID 19374978
(5E)-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-methylimidazolidine-2,4-dione (PubChem CID 19374978) has the molecular formula C11H8Br2N2O3 and a molecular weight of 376.00 g/mol. Its IUPAC name is (5E)-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-methylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 19374978 |
| Molecular Formula | C11H8Br2N2O3 |
| Molecular Weight | 376.00 g/mol |
| Exact Mass | 373.89 |
| IUPAC Name | (5E)-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N/C(=C/c2cc(Br)c(O)c(Br)c2)C1=O |
| InChI | InChI=1S/C11H8Br2N2O3/c1-15-10(17)8(14-11(15)18)4-5-2-6(12)9(16)7(13)3-5/h2-4,16H,1H3,(H,14,18)/b8-4+ |
| InChIKey | IYINTGNJQRFJLC-XBXARRHUSA-N |
| XLogP | 2.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.00 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|