C15H15BrN2O6 — CID 4008187
methyl 2-[4-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 4008187) has the molecular formula C15H15BrN2O6 and a molecular weight of 399.20 g/mol. Its IUPAC name is methyl 2-[4-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[4-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 4008187 |
| Molecular Formula | C15H15BrN2O6 |
| Molecular Weight | 399.20 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | methyl 2-[4-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CCOc1cc(C=C2NC(=O)N(CC(=O)OC)C2=O)cc(Br)c1O |
| InChI | InChI=1S/C15H15BrN2O6/c1-3-24-11-6-8(4-9(16)13(11)20)5-10-14(21)18(15(22)17-10)7-12(19)23-2/h4-6,20H,3,7H2,1-2H3,(H,17,22) |
| InChIKey | AAPFQKZWDXMKKC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|