C16H16Br2N2O3 — CID 126092252
(5Z)-3-cyclohexyl-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 126092252) has the molecular formula C16H16Br2N2O3 and a molecular weight of 444.12 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-3-cyclohexyl-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126092252 |
| Molecular Formula | C16H16Br2N2O3 |
| Molecular Weight | 444.12 g/mol |
| Exact Mass | 441.95 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-[(3,5-dibromo-4-hydroxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C\c2cc(Br)c(O)c(Br)c2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C16H16Br2N2O3/c17-11-6-9(7-12(18)14(11)21)8-13-15(22)20(16(23)19-13)10-4-2-1-3-5-10/h6-8,10,21H,1-5H2,(H,19,23)/b13-8- |
| InChIKey | OXLAWLWWVSTBFC-JYRVWZFOSA-N |
| XLogP | 4.14 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.12 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|